Visit our website to find more information like suppliers, MSDS, infra-red (IR), nuclear magnetic resonance spectra (NMR), bp, mp, nd20, molecular formula (MF), molfile, sdf file, structure, 3d model. You will also find information like safety, risk, hazard and MSDS.
This database is a catalog of over 1500000 chemicals and over 1000 chemical suppliers. If you are a supplier you may also add your own catalog of chemicals.
| Chloroquine phosphate |
| Aralen phosphate |
|
Predict NMR spectrum
|
|
| InChI: |
1S/C18H26ClN3.2H3O4P/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18;2*1-5(2,3)4/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21);2*(H3,1,2,3,4) |
| InChIKey: |
QKICWELGRMTQCR-UHFFFAOYSA-N |
|
| H donor: |
7 |
| H acceptor: |
11 |
| Rotatable bond: |
8 |
| Stereocenter: |
1 |
|
| cLogP: |
-6.175 |
| cLogS: |
0.916 |
| Polar surface: |
203.3 |
|
|
Permanent link: http://www.chemexper.com/search/cas/50635.html
|
Report error(s)
|
|
Click on a product name to get more information on that compound, on a supplier name to get more information on that supplier.
|
|
Supplier
|
Description
|
Reference
|
| amadischem
|
Chloroquine phosphate, 98%
|
|
| advtechind
|
chloroquine diphosphate 98%
|
|
| aifchem
|
N4-(7-Chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine bis(phosphate), 98%
|
|
| leapchem
|
chloroquine diphosphate
|
|
| leapchem
|
chloroquine diphosphate, 99%
|
|
| alfa-chemistry
|
|
|
| leapchem
|
chloroquine diphosphate
|
|
| cm-finechemicals
|
Chloroquine Diphosphate Salt
|
|
| bocsci
|
Chloroquine phosphate, ≥98% (HPLC)
|
|
| advtechind
|
chloroquine phosphate, usp standard
|
|
| protheragen
|
Chloroquine Phosphate
|
|
| carbonesci
|
Chloroquine diphosphate, 99%
|
|
| lingruichem
|
Chloroquine diphosphate
|
|
| lingruichem
|
Chloroquine diphosphate
|
|
| lingruichem
|
Chloroquine phosphate
|
|
| lingruichem
|
Chloroquine diphosphate
|
|
| oakwood
|
| Chloroquine diphosphate salt |
| , 98%
|
|
|
| aboundchem
|
Chloroquine phosphate, 98%
|
|
| rosewachem
|
Chloroquine diphosphate
|
|
| rosewachem
|
Chloroquine diphosphate
|
|
List all chemical suppliers for this product and get quotes
ChemExper Chemical Directory : catalog of chemicals and suppliers